C26H24B3N5O3S — CID 174012635
CID 174012635 (PubChem CID 174012635) has the molecular formula C26H24B3N5O3S and a molecular weight of 519.01 g/mol.
| Compound Name | CID 174012635 |
|---|---|
| PubChem CID | 174012635 |
| Molecular Formula | C26H24B3N5O3S |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(C(=O)c1nn(-c2ccsc2)c2c1COc1cc(OC)c(-c3ccn(C)n3)cc1-2)C1CCCC1 |
| InChI | InChI=1S/C26H24B3N5O3S/c1-32-9-7-20(30-32)17-11-18-22(12-21(17)36-2)37-13-19-23(31-34(24(18)19)16-8-10-38-14-16)25(35)33(26(27,28)29)15-5-3-4-6-15/h7-12,14-15H,3-6,13H2,1-2H3 |
| InChIKey | XHRMNDDHXRFBDO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|