C12H20F5NOS — CID 174013298
tert-butyl-[[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]amino]-oxidosulfanium (PubChem CID 174013298) has the molecular formula C12H20F5NOS and a molecular weight of 321.36 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174013298 |
| Molecular Formula | C12H20F5NOS |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | tert-butyl-[[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](C1CCCC(F)(F)C1)C(F)(F)F |
| InChI | InChI=1S/C12H20F5NOS/c1-10(2,3)20(19)18-9(12(15,16)17)8-5-4-6-11(13,14)7-8/h8-9,18H,4-7H2,1-3H3/t8?,9-,20?/m0/s1 |
| InChIKey | RTMFHDSLPNGVOD-NVILFLNQSA-N |
| XLogP | 3.79 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|