C33H31BF2N6O2 — CID 174013900
4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7-[[3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyrrolo[1,2-b]pyridazine (PubChem CID 174013900) has the molecular formula C33H31BF2N6O2 and a molecular weight of 592.46 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7-[[3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyrrolo[1,2-b]pyridazine.
| Compound Name | 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7-[[3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyrrolo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 174013900 |
| Molecular Formula | C33H31BF2N6O2 |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7-[[3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyrrolo[1,2-b]pyridazine |
| SMILES | Cn1cc(-c2ccnn3c(Cn4cc(B5OC(C)(C)C(C)(C)O5)c(-c5ccc(F)cc5)n4)ccc23)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C33H31BF2N6O2/c1-32(2)33(3,4)44-34(43-32)28-20-41(39-31(28)22-8-12-24(36)13-9-22)18-25-14-15-29-26(16-17-37-42(25)29)27-19-40(5)38-30(27)21-6-10-23(35)11-7-21/h6-17,19-20H,18H2,1-5H3 |
| InChIKey | QVXPNCDOXJNOLE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 71.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|