About CID 174014281
CID 174014281 (PubChem CID 174014281) has the molecular formula C6H3B2Cl
and a molecular weight of 132.17 g/mol.
Molecular Properties
| Compound Name | CID 174014281 |
| PubChem CID | 174014281 |
| Molecular Formula | C6H3B2Cl |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | — |
| SMILES | [B]c1cc([B])cc(Cl)c1 |
| InChI | InChI=1S/C6H3B2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | MELAMXJIYCXRNF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174014281 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174014281?
The IUPAC name of CID 174014281 (CID 174014281) is not available.
What is the SMILES notation for CID 174014281?
The canonical SMILES for CID 174014281 is [B]c1cc([B])cc(Cl)c1.
What is the InChIKey of CID 174014281?
The InChIKey is MELAMXJIYCXRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3B2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H.
What are the key properties of CID 174014281?
CID 174014281 has a molecular weight of 132.17 g/mol, XLogP of -0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174014281 is sourced from PubChem (CID 174014281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).