C61H68BN2S — CID 174015478
CID 174015478 (PubChem CID 174015478) has the molecular formula C61H68BN2S and a molecular weight of 872.11 g/mol.
| Compound Name | CID 174015478 |
|---|---|
| PubChem CID | 174015478 |
| Molecular Formula | C61H68BN2S |
| Molecular Weight | 872.11 g/mol |
| Exact Mass | 871.52 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2c(Nc3ccc4c(c3)C(C)(C)CCC4(C)C)ccc3c2sc2ccccc23)c2c(c1)N(c1ccc3c(c1)C(C)(C)CCC3(C)C)c1cc3c(cc1[B]2)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C61H68BN2S/c1-36-30-41(53-49(23-20-40-39-16-14-15-17-52(39)65-55(40)53)63-37-18-21-42-44(32-37)58(6,7)26-24-56(42,2)3)54-51(31-36)64(38-19-22-43-45(33-38)59(8,9)27-25-57(43,4)5)50-35-47-46(34-48(50)62-54)60(10,11)28-29-61(47,12)13/h14-23,30-35,63H,24-29H2,1-13H3 |
| InChIKey | BNRXXHSSZFXMPV-UHFFFAOYSA-N |
| XLogP | 16.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.11 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|