C18H12B5F3N6O2 — CID 174017392
CID 174017392 (PubChem CID 174017392) has the molecular formula C18H12B5F3N6O2 and a molecular weight of 455.39 g/mol.
| Compound Name | CID 174017392 |
|---|---|
| PubChem CID | 174017392 |
| Molecular Formula | C18H12B5F3N6O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(c1cnc2nn(-c3cc(NC(=O)N4CC(F)(F)C4)ccc3F)cc2c1)C([B])([B])O |
| InChI | InChI=1S/C18H12B5F3N6O2/c19-17(20,21)32(18(22,23)34)11-3-9-6-31(29-14(9)27-5-11)13-4-10(1-2-12(13)24)28-15(33)30-7-16(25,26)8-30/h1-6,34H,7-8H2,(H,28,33) |
| InChIKey | QHRJYLQSDSBDAD-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|