About CID 174017585
CID 174017585 (PubChem CID 174017585) has the molecular formula C54H42BN2O
and a molecular weight of 745.76 g/mol.
Molecular Properties
| Compound Name | CID 174017585 |
| PubChem CID | 174017585 |
| Molecular Formula | C54H42BN2O |
| Molecular Weight | 745.76 g/mol |
| Exact Mass | 745.34 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cc(-c3cc(-c4ccccc4)ccc3Nc3cccc4c3oc3ccccc34)c3c(c2)N2c4ccccc4C(C)(C)c4cccc(c42)[B]3)c(C)c1 |
| InChI | InChI=1S/C54H42BN2O/c1-32-27-33(2)50(34(3)28-32)37-30-41(51-48(31-37)57-47-23-11-10-19-42(47)54(4,5)43-20-14-21-44(55-51)52(43)57)40-29-36(35-15-7-6-8-16-35)25-26-45(40)56-46-22-13-18-39-38-17-9-12-24-49(38)58-53(39)46/h6-31,56H,1-5H3 |
| InChIKey | LCHJATSRACHBAO-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 745.76 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174017585 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174017585?
The IUPAC name of CID 174017585 (CID 174017585) is not available.
What is the SMILES notation for CID 174017585?
The canonical SMILES for CID 174017585 is Cc1cc(C)c(-c2cc(-c3cc(-c4ccccc4)ccc3Nc3cccc4c3oc3ccccc34)c3c(c2)N2c4ccccc4C(C)(C)c4cccc(c42)[B]3)c(C)c1.
What is the InChIKey of CID 174017585?
The InChIKey is LCHJATSRACHBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H42BN2O/c1-32-27-33(2)50(34(3)28-32)37-30-41(51-48(31-37)57-47-23-11-10-19-42(47)54(4,5)43-20-14-21-44(55-51)52(43)57)40-29-36(35-15-7-6-8-16-35)25-26-45(40)56-46-22-13-18-39-38-17-9-12-24-49(38)58-53(39)46/h6-31,56H,1-5H3.
What are the key properties of CID 174017585?
CID 174017585 has a molecular weight of 745.76 g/mol, XLogP of 13.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174017585 is sourced from PubChem (CID 174017585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).