C49H36BN2OS — CID 174017629
CID 174017629 (PubChem CID 174017629) has the molecular formula C49H36BN2OS and a molecular weight of 711.72 g/mol.
| Compound Name | CID 174017629 |
|---|---|
| PubChem CID | 174017629 |
| Molecular Formula | C49H36BN2OS |
| Molecular Weight | 711.72 g/mol |
| Exact Mass | 711.26 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccc3c2[nH]c2c4ccccc4sc32)c2c(c1)N(c1ccc(C(C)(C)C)cc1-c1ccccc1)c1c(ccc3oc4ccccc4c13)[B]2 |
| InChI | InChI=1S/C49H36BN2OS/c1-28-25-36(31-17-12-18-34-45(31)51-46-33-16-9-11-20-42(33)54-48(34)46)44-39(26-28)52(38-23-21-30(49(2,3)4)27-35(38)29-13-6-5-7-14-29)47-37(50-44)22-24-41-43(47)32-15-8-10-19-40(32)53-41/h5-27,51H,1-4H3 |
| InChIKey | VXFNWSMXXMLNNP-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 32.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.72 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|