C21H22N2O8 — CID 17401843
N-(4-acetylphenyl)-2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]acetamide;oxalic acid (PubChem CID 17401843) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]acetamide;oxalic acid.
| Compound Name | N-(4-acetylphenyl)-2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 17401843 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-(4-acetylphenyl)-2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]acetamide;oxalic acid |
| SMILES | CC(=O)c1ccc(NC(=O)CN(C)Cc2ccc3c(c2)OCO3)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20N2O4.C2H2O4/c1-13(22)15-4-6-16(7-5-15)20-19(23)11-21(2)10-14-3-8-17-18(9-14)25-12-24-17;3-1(4)2(5)6/h3-9H,10-12H2,1-2H3,(H,20,23);(H,3,4)(H,5,6) |
| InChIKey | DTMSGNCGUUTWFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|