About (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine
(5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine (PubChem CID 174018685) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine.
Molecular Properties
| Compound Name | (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine |
| PubChem CID | 174018685 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine |
| SMILES | C=C/C=C1/[C@H](CC)CC=NN1C |
| InChI | InChI=1S/C10H16N2/c1-4-6-10-9(5-2)7-8-11-12(10)3/h4,6,8-9H,1,5,7H2,2-3H3/b10-6-/t9-/m1/s1 |
| InChIKey | YMSYMMJJBQIMJX-WPVMNKCKSA-N |
| XLogP | 2.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine?
The IUPAC name of (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine (CID 174018685) is (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine.
What is the SMILES notation for (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine?
The canonical SMILES for (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine is C=C/C=C1/[C@H](CC)CC=NN1C.
What is the InChIKey of (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine?
The InChIKey is YMSYMMJJBQIMJX-WPVMNKCKSA-N. The full InChI is InChI=1S/C10H16N2/c1-4-6-10-9(5-2)7-8-11-12(10)3/h4,6,8-9H,1,5,7H2,2-3H3/b10-6-/t9-/m1/s1.
What are the key properties of (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine?
(5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine has a molecular weight of 164.25 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6Z)-5-ethyl-1-methyl-6-prop-2-enylidene-4,5-dihydropyridazine is sourced from PubChem (CID 174018685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).