C9H13N3 — CID 174018766
6,7,10,11-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azonine (PubChem CID 174018766) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,7,10,11-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azonine.
| Compound Name | 6,7,10,11-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azonine |
|---|---|
| PubChem CID | 174018766 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 6,7,10,11-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azonine |
| SMILES | C1=CCCc2nncn2CCC1 |
| InChI | InChI=1S/C9H13N3/c1-2-4-6-9-11-10-8-12(9)7-5-3-1/h1-2,8H,3-7H2 |
| InChIKey | UMKBCRGTRBWIBO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|