C34H55F3N6O5 — CID 174019129
16,19-difluoro-9-(2-fluoroethoxy)-8-hydroxy-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 174019129) has the molecular formula C34H55F3N6O5 and a molecular weight of 684.84 g/mol. Its IUPAC name is 16,19-difluoro-9-(2-fluoroethoxy)-8-hydroxy-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 16,19-difluoro-9-(2-fluoroethoxy)-8-hydroxy-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 174019129 |
| Molecular Formula | C34H55F3N6O5 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.42 |
| IUPAC Name | 16,19-difluoro-9-(2-fluoroethoxy)-8-hydroxy-22-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | C=CC(=O)N1CCN(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2OCC(OCCF)C(O)C2CCNC(C(C)C)C23)[C@@H](C)C1 |
| InChI | InChI=1S/C34H55F3N6O5/c1-5-26(44)41-12-13-42(19(4)16-41)32-21-15-23(37)29-27-22(36)7-6-8-24(27)48-17-25(47-14-10-35)31(45)20-9-11-38-28(18(2)3)30(20)43(33(21)39-29)34(46)40-32/h5,18-25,27-33,38-39,45H,1,6-17H2,2-4H3,(H,40,46)/t19-,20?,21?,22?,23?,24?,25?,27?,28?,29?,30?,31?,32?,33?/m0/s1 |
| InChIKey | UOTOPXBMYQIMLU-DMILGRNYSA-N |
| XLogP | 1.95 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|