C30H51ClF2N6O4 — CID 174019175
15-chloro-22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-8,9-dihydroxy-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 174019175) has the molecular formula C30H51ClF2N6O4 and a molecular weight of 633.23 g/mol. Its IUPAC name is 15-chloro-22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-8,9-dihydroxy-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 15-chloro-22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-8,9-dihydroxy-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 174019175 |
| Molecular Formula | C30H51ClF2N6O4 |
| Molecular Weight | 633.23 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | 15-chloro-22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-8,9-dihydroxy-3-propan-2-yl-11-oxa-1,4,23,26-tetrazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | CC(C)C1NCCC2C(O)C(O)COC3CCC(Cl)C(F)C3C3NC4C(CC3F)C(N3C[C@@H](C)NC[C@@H]3C)NC(=O)N4C21 |
| InChI | InChI=1S/C30H51ClF2N6O4/c1-13(2)24-26-16(7-8-34-24)27(41)20(40)12-43-21-6-5-18(31)23(33)22(21)25-19(32)9-17-28(37-30(42)39(26)29(17)36-25)38-11-14(3)35-10-15(38)4/h13-29,34-36,40-41H,5-12H2,1-4H3,(H,37,42)/t14-,15+,16?,17?,18?,19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | NJJRYOHORKNZIX-ANSNSQDLSA-N |
| XLogP | 1.14 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|