C14H28FN — CID 174019251
(E,3S,4R)-8-fluoro-N,3,4-trimethylundec-8-en-1-amine (PubChem CID 174019251) has the molecular formula C14H28FN and a molecular weight of 229.38 g/mol. Its IUPAC name is (E,3S,4R)-8-fluoro-N,3,4-trimethylundec-8-en-1-amine.
| Compound Name | (E,3S,4R)-8-fluoro-N,3,4-trimethylundec-8-en-1-amine |
|---|---|
| PubChem CID | 174019251 |
| Molecular Formula | C14H28FN |
| Molecular Weight | 229.38 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | (E,3S,4R)-8-fluoro-N,3,4-trimethylundec-8-en-1-amine |
| SMILES | CC/C=C(/F)CCC[C@@H](C)[C@@H](C)CCNC |
| InChI | InChI=1S/C14H28FN/c1-5-7-14(15)9-6-8-12(2)13(3)10-11-16-4/h7,12-13,16H,5-6,8-11H2,1-4H3/b14-7+/t12-,13+/m1/s1 |
| InChIKey | FJXNPHTYQOJUMI-DNLHMGNTSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |