C12H19N — CID 174019326
(3S)-4-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 174019326) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3S)-4-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3,4,5-tetrahydropyridine.
| Compound Name | (3S)-4-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 174019326 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3S)-4-[(2Z,4Z)-hexa-2,4-dienyl]-3-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | C/C=C\C=C/CC1CC=NC[C@H]1C |
| InChI | InChI=1S/C12H19N/c1-3-4-5-6-7-12-8-9-13-10-11(12)2/h3-6,9,11-12H,7-8,10H2,1-2H3/b4-3-,6-5-/t11-,12?/m1/s1 |
| InChIKey | MIMFOXJWLWKVOR-HPCHIYFRSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|