About 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one
4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one (PubChem CID 174019343) has the molecular formula C13H13F3N2OS
and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one |
| PubChem CID | 174019343 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one |
| SMILES | C=C(/C(=C\C)c1cnc(C(=CN)C(C)=O)s1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2OS/c1-4-9(7(2)13(14,15)16)11-6-18-12(20-11)10(5-17)8(3)19/h4-6H,2,17H2,1,3H3/b9-4+,10-5? |
| InChIKey | XDZWWBFASVBJHZ-KWBNEJDUSA-N |
| XLogP | 3.55 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one?
The IUPAC name of 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one (CID 174019343) is 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one.
What is the SMILES notation for 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one?
The canonical SMILES for 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one is C=C(/C(=C\C)c1cnc(C(=CN)C(C)=O)s1)C(F)(F)F.
What is the InChIKey of 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one?
The InChIKey is XDZWWBFASVBJHZ-KWBNEJDUSA-N. The full InChI is InChI=1S/C13H13F3N2OS/c1-4-9(7(2)13(14,15)16)11-6-18-12(20-11)10(5-17)8(3)19/h4-6H,2,17H2,1,3H3/b9-4+,10-5?.
What are the key properties of 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one?
4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one has a molecular weight of 302.32 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-[5-[(3E)-2-(trifluoromethyl)penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one is sourced from PubChem (CID 174019343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).