C17H20N4O2S2 — CID 174019357
2-[[3-amino-2-[5-[(3E)-penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]prop-2-enoyl]amino]-3-methyl-2,3-dihydrothiophene-5-carboxamide (PubChem CID 174019357) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-[[3-amino-2-[5-[(3E)-penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]prop-2-enoyl]amino]-3-methyl-2,3-dihydrothiophene-5-carboxamide.
| Compound Name | 2-[[3-amino-2-[5-[(3E)-penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]prop-2-enoyl]amino]-3-methyl-2,3-dihydrothiophene-5-carboxamide |
|---|---|
| PubChem CID | 174019357 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[[3-amino-2-[5-[(3E)-penta-1,3-dien-3-yl]-1,3-thiazol-2-yl]prop-2-enoyl]amino]-3-methyl-2,3-dihydrothiophene-5-carboxamide |
| SMILES | C=C/C(=C\C)c1cnc(C(=CN)C(=O)NC2SC(C(N)=O)=CC2C)s1 |
| InChI | InChI=1S/C17H20N4O2S2/c1-4-10(5-2)13-8-20-17(25-13)11(7-18)15(23)21-16-9(3)6-12(24-16)14(19)22/h4-9,16H,1,18H2,2-3H3,(H2,19,22)(H,21,23)/b10-5+,11-7? |
| InChIKey | GOKAJSVDZQCUIL-SFFKRVFVSA-N |
| XLogP | 2.23 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|