C30H30ClFN5O5SSi — CID 174019404
CID 174019404 (PubChem CID 174019404) has the molecular formula C30H30ClFN5O5SSi and a molecular weight of 655.20 g/mol.
| Compound Name | CID 174019404 |
|---|---|
| PubChem CID | 174019404 |
| Molecular Formula | C30H30ClFN5O5SSi |
| Molecular Weight | 655.20 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[Si](C)N(c2nc(=O)n(-c3c(CC)cccc3S(C)(=O)=O)c3nc(-c4c(O)cccc4F)c(Cl)cc23)C[C@H]1C |
| InChI | InChI=1S/C30H30ClFN5O5SSi/c1-6-18-10-8-13-23(43(4,41)42)27(18)37-29-19(14-20(31)26(33-29)25-21(32)11-9-12-22(25)38)28(34-30(37)40)36-15-17(3)35(16-44(36)5)24(39)7-2/h7-14,17,38H,2,6,15-16H2,1,3-5H3/t17-/m1/s1 |
| InChIKey | GFPVLVKEPOQHBX-QGZVFWFLSA-N |
| XLogP | 4.30 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|