C23H43N — CID 174019475
N-[(5Z)-5-ethylidene-4,8,8-trimethyl-3-[(E)-pent-2-en-3-yl]dodecan-2-yl]methanimine (PubChem CID 174019475) has the molecular formula C23H43N and a molecular weight of 333.60 g/mol. Its IUPAC name is N-[(5Z)-5-ethylidene-4,8,8-trimethyl-3-[(E)-pent-2-en-3-yl]dodecan-2-yl]methanimine.
| Compound Name | N-[(5Z)-5-ethylidene-4,8,8-trimethyl-3-[(E)-pent-2-en-3-yl]dodecan-2-yl]methanimine |
|---|---|
| PubChem CID | 174019475 |
| Molecular Formula | C23H43N |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 333.34 |
| IUPAC Name | N-[(5Z)-5-ethylidene-4,8,8-trimethyl-3-[(E)-pent-2-en-3-yl]dodecan-2-yl]methanimine |
| SMILES | C=NC(C)C(/C(=C/C)CC)C(C)/C(=C\C)CCC(C)(C)CCCC |
| InChI | InChI=1S/C23H43N/c1-10-14-16-23(7,8)17-15-21(13-4)18(5)22(19(6)24-9)20(11-2)12-3/h11,13,18-19,22H,9-10,12,14-17H2,1-8H3/b20-11+,21-13- |
| InChIKey | FDNGHEYDOIAITN-YHRCPZTASA-N |
| XLogP | 7.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|