C32H36BN8O3PS — CID 174019489
CID 174019489 (PubChem CID 174019489) has the molecular formula C32H36BN8O3PS and a molecular weight of 654.55 g/mol.
| Compound Name | CID 174019489 |
|---|---|
| PubChem CID | 174019489 |
| Molecular Formula | C32H36BN8O3PS |
| Molecular Weight | 654.55 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | — |
| SMILES | [B]C(P)Oc1ccc(SC)cc1-c1nn(CC(=O)N2CCC(N3CCCC(C#C)C3)CC2)cc1NC(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C32H36BN8O3PS/c1-3-21-6-4-12-39(18-21)22-9-14-38(15-10-22)28(42)20-40-19-26(36-31(43)25-17-35-41-13-5-11-34-30(25)41)29(37-40)24-16-23(46-2)7-8-27(24)44-32(33)45/h1,5,7-8,11,13,16-17,19,21-22,32H,4,6,9-10,12,14-15,18,20,45H2,2H3,(H,36,43) |
| InChIKey | IWPVUNBWHJIODN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|