C26H23ClF3N7O4 — CID 174020454
3-chloro-5-[5-[(2S,5R)-3-hydroxy-6-(1-hydroxyethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]-3-methyl-1,2,4-triazol-1-yl]pyridine-2-carbonitrile (PubChem CID 174020454) has the molecular formula C26H23ClF3N7O4 and a molecular weight of 589.96 g/mol. Its IUPAC name is 3-chloro-5-[5-[(2S,5R)-3-hydroxy-6-(1-hydroxyethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]-3-methyl-1,2,4-triazol-1-yl]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-5-[5-[(2S,5R)-3-hydroxy-6-(1-hydroxyethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]-3-methyl-1,2,4-triazol-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 174020454 |
| Molecular Formula | C26H23ClF3N7O4 |
| Molecular Weight | 589.96 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 3-chloro-5-[5-[(2S,5R)-3-hydroxy-6-(1-hydroxyethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]-3-methyl-1,2,4-triazol-1-yl]pyridine-2-carbonitrile |
| SMILES | CO[C@H]1C(C(C)O)O[C@@H](c2nc(C)nn2-c2cnc(C#N)c(Cl)c2)C(O)C1n1cc(-c2cc(F)c(F)c(F)c2)cn1 |
| InChI | InChI=1S/C26H23ClF3N7O4/c1-11(38)23-24(40-3)21(36-10-14(8-33-36)13-4-17(28)20(30)18(29)5-13)22(39)25(41-23)26-34-12(2)35-37(26)15-6-16(27)19(7-31)32-9-15/h4-6,8-11,21-25,38-39H,1-3H3/t11?,21?,22?,23?,24-,25-/m1/s1 |
| InChIKey | QHOCVCAZODAHSA-YAMGQWEXSA-N |
| XLogP | 3.21 |
| TPSA | 144.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|