C13H17N3 — CID 174020640
(6Z,8Z)-1-methyl-2-methylimino-3,4-dihydrocycloocta[b]pyridin-5-amine (PubChem CID 174020640) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (6Z,8Z)-1-methyl-2-methylimino-3,4-dihydrocycloocta[b]pyridin-5-amine.
| Compound Name | (6Z,8Z)-1-methyl-2-methylimino-3,4-dihydrocycloocta[b]pyridin-5-amine |
|---|---|
| PubChem CID | 174020640 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (6Z,8Z)-1-methyl-2-methylimino-3,4-dihydrocycloocta[b]pyridin-5-amine |
| SMILES | C/N=C1\CCC2=C(N)/C=C\C=C/C=C2N1C |
| InChI | InChI=1S/C13H17N3/c1-15-13-9-8-10-11(14)6-4-3-5-7-12(10)16(13)2/h3-7H,8-9,14H2,1-2H3/b4-3-,5-3-,6-4-,7-5?,11-6?,11-10?,12-7?,15-13+ |
| InChIKey | DSEUXDQOLFLUCW-FAJFNZNVSA-N |
| XLogP | 1.96 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|