About [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate
[(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate (PubChem CID 174020740) has the molecular formula C15H25FO7
and a molecular weight of 336.36 g/mol. Its IUPAC name is [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate |
| PubChem CID | 174020740 |
| Molecular Formula | C15H25FO7 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate |
| SMILES | COC[C@H](F)C(C)C(OC(C)=O)C(OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C15H25FO7/c1-8(13(16)7-20-6)14(22-11(4)18)15(23-12(5)19)9(2)21-10(3)17/h8-9,13-15H,7H2,1-6H3/t8?,9-,13-,14?,15?/m0/s1 |
| InChIKey | DKXXUBAMOOZCGD-ZSLOWUQCSA-N |
| XLogP | 1.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate?
The IUPAC name of [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate (CID 174020740) is [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate.
What is the SMILES notation for [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate?
The canonical SMILES for [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate is COC[C@H](F)C(C)C(OC(C)=O)C(OC(C)=O)[C@H](C)OC(C)=O.
What is the InChIKey of [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate?
The InChIKey is DKXXUBAMOOZCGD-ZSLOWUQCSA-N. The full InChI is InChI=1S/C15H25FO7/c1-8(13(16)7-20-6)14(22-11(4)18)15(23-12(5)19)9(2)21-10(3)17/h8-9,13-15H,7H2,1-6H3/t8?,9-,13-,14?,15?/m0/s1.
What are the key properties of [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate?
[(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate has a molecular weight of 336.36 g/mol, XLogP of 1.42, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,6R)-3,4-diacetyloxy-6-fluoro-7-methoxy-5-methylheptan-2-yl] acetate is sourced from PubChem (CID 174020740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).