About (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine
(10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine (PubChem CID 174020917) has the molecular formula C16H23FN2
and a molecular weight of 262.37 g/mol. Its IUPAC name is (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine.
Molecular Properties
| Compound Name | (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine |
| PubChem CID | 174020917 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine |
| SMILES | C/C=C1/CC2=CC(CCC(F)C(C)=C2)N/C1=N\CC |
| InChI | InChI=1S/C16H23FN2/c1-4-13-9-12-8-11(3)15(17)7-6-14(10-12)19-16(13)18-5-2/h4,8,10,14-15H,5-7,9H2,1-3H3,(H,18,19)/b11-8?,13-4- |
| InChIKey | FSTXHGAYIDBPEQ-STWJGANSSA-N |
| XLogP | 3.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine?
The IUPAC name of (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine (CID 174020917) is (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine.
What is the SMILES notation for (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine?
The canonical SMILES for (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine is C/C=C1/CC2=CC(CCC(F)C(C)=C2)N/C1=N\CC.
What is the InChIKey of (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine?
The InChIKey is FSTXHGAYIDBPEQ-STWJGANSSA-N. The full InChI is InChI=1S/C16H23FN2/c1-4-13-9-12-8-11(3)15(17)7-6-14(10-12)19-16(13)18-5-2/h4,8,10,14-15H,5-7,9H2,1-3H3,(H,18,19)/b11-8?,13-4-.
What are the key properties of (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine?
(10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine has a molecular weight of 262.37 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10Z)-N-ethyl-10-ethylidene-4-fluoro-3-methyl-8-azabicyclo[5.4.1]dodeca-1(12),2-dien-9-imine is sourced from PubChem (CID 174020917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).