C26H23F3N6O3S — CID 174021130
[N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-yl-5-(trifluoromethyl)thiophene-3-carboximidate (PubChem CID 174021130) has the molecular formula C26H23F3N6O3S and a molecular weight of 556.57 g/mol. Its IUPAC name is [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-yl-5-(trifluoromethyl)thiophene-3-carboximidate.
| Compound Name | [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-yl-5-(trifluoromethyl)thiophene-3-carboximidate |
|---|---|
| PubChem CID | 174021130 |
| Molecular Formula | C26H23F3N6O3S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [N'-[(3R)-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamimidoyl] 2-morpholin-4-yl-5-(trifluoromethyl)thiophene-3-carboximidate |
| SMILES | [H]/N=C(/OC(N)=N[C@H]1N=C(c2ccccc2)c2ccccc2NC1=O)c1cc(C(F)(F)F)sc1N1CCOCC1 |
| InChI | InChI=1S/C26H23F3N6O3S/c27-26(28,29)19-14-17(24(39-19)35-10-12-37-13-11-35)21(30)38-25(31)34-22-23(36)32-18-9-5-4-8-16(18)20(33-22)15-6-2-1-3-7-15/h1-9,14,22,30H,10-13H2,(H2,31,34)(H,32,36)/b30-21+/t22-/m1/s1 |
| InChIKey | NORZNFDDVBDOCU-CWPBYQMCSA-N |
| XLogP | 4.08 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|