C32H50N2 — CID 174021174
(4E,6Z)-4-ethenyl-3,7-dimethyl-1-[2-[(2E,4Z)-2-(4-methylhexan-3-yl)-6-methyliminohexa-2,4-dienyl]cyclopenta-2,4-dien-1-yl]nona-4,6-dien-1-amine (PubChem CID 174021174) has the molecular formula C32H50N2 and a molecular weight of 462.77 g/mol. Its IUPAC name is (4E,6Z)-4-ethenyl-3,7-dimethyl-1-[2-[(2E,4Z)-2-(4-methylhexan-3-yl)-6-methyliminohexa-2,4-dienyl]cyclopenta-2,4-dien-1-yl]nona-4,6-dien-1-amine.
| Compound Name | (4E,6Z)-4-ethenyl-3,7-dimethyl-1-[2-[(2E,4Z)-2-(4-methylhexan-3-yl)-6-methyliminohexa-2,4-dienyl]cyclopenta-2,4-dien-1-yl]nona-4,6-dien-1-amine |
|---|---|
| PubChem CID | 174021174 |
| Molecular Formula | C32H50N2 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | (4E,6Z)-4-ethenyl-3,7-dimethyl-1-[2-[(2E,4Z)-2-(4-methylhexan-3-yl)-6-methyliminohexa-2,4-dienyl]cyclopenta-2,4-dien-1-yl]nona-4,6-dien-1-amine |
| SMILES | C=C/C(=C\C=C(\C)CC)C(C)CC(N)C1C=CC=C1C/C(=C\C=C/C=N/C)C(CC)C(C)CC |
| InChI | InChI=1S/C32H50N2/c1-9-24(5)19-20-27(11-3)26(7)22-32(33)31-18-15-17-29(31)23-28(16-13-14-21-34-8)30(12-4)25(6)10-2/h11,13-21,25-26,30-32H,3,9-10,12,22-23,33H2,1-2,4-8H3/b14-13-,24-19-,27-20+,28-16+,34-21+ |
| InChIKey | SAMJDIVGMGVJPZ-UCCUJWFRSA-N |
| XLogP | 8.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|