C24H24BClN4O6 — CID 174021264
CID 174021264 (PubChem CID 174021264) has the molecular formula C24H24BClN4O6 and a molecular weight of 510.74 g/mol.
| Compound Name | CID 174021264 |
|---|---|
| PubChem CID | 174021264 |
| Molecular Formula | C24H24BClN4O6 |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | — |
| SMILES | [B]C1(O)Oc2ccc(-n3c(Cl)cc4c(=O)n(CC5(O)CCN(C(=O)C6(C)CC6)CC5)cnc43)cc2O1 |
| InChI | InChI=1S/C24H24BClN4O6/c1-22(4-5-22)21(32)28-8-6-23(33,7-9-28)12-29-13-27-19-15(20(29)31)11-18(26)30(19)14-2-3-16-17(10-14)36-24(25,34)35-16/h2-3,10-11,13,33-34H,4-9,12H2,1H3 |
| InChIKey | AHISXGGIURQXRQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|