C9H16FIN2 — CID 174021374
(2S,5R)-N-(2-fluoropropyl)-1-iodo-2,5-dimethyl-2,5-dihydropyrrol-3-amine (PubChem CID 174021374) has the molecular formula C9H16FIN2 and a molecular weight of 298.14 g/mol. Its IUPAC name is (2S,5R)-N-(2-fluoropropyl)-1-iodo-2,5-dimethyl-2,5-dihydropyrrol-3-amine.
| Compound Name | (2S,5R)-N-(2-fluoropropyl)-1-iodo-2,5-dimethyl-2,5-dihydropyrrol-3-amine |
|---|---|
| PubChem CID | 174021374 |
| Molecular Formula | C9H16FIN2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2S,5R)-N-(2-fluoropropyl)-1-iodo-2,5-dimethyl-2,5-dihydropyrrol-3-amine |
| SMILES | CC(F)CNC1=C[C@@H](C)N(I)[C@H]1C |
| InChI | InChI=1S/C9H16FIN2/c1-6(10)5-12-9-4-7(2)13(11)8(9)3/h4,6-8,12H,5H2,1-3H3/t6?,7-,8+/m1/s1 |
| InChIKey | QOKHEYXJEOEQDQ-VVXQKDJTSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|