About 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide
2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide (PubChem CID 174021445) has the molecular formula C8H16N6
and a molecular weight of 196.26 g/mol. Its IUPAC name is 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide.
Molecular Properties
| Compound Name | 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide |
| PubChem CID | 174021445 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide |
| SMILES | CCNC(NC)=C(C#N)C(N)=NNC |
| InChI | InChI=1S/C8H16N6/c1-4-13-8(11-2)6(5-9)7(10)14-12-3/h11-13H,4H2,1-3H3,(H2,10,14) |
| InChIKey | RMFOWBVAYZMDEJ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide?
The IUPAC name of 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide (CID 174021445) is 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide.
What is the SMILES notation for 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide?
The canonical SMILES for 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide is CCNC(NC)=C(C#N)C(N)=NNC.
What is the InChIKey of 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide?
The InChIKey is RMFOWBVAYZMDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N6/c1-4-13-8(11-2)6(5-9)7(10)14-12-3/h11-13H,4H2,1-3H3,(H2,10,14).
What are the key properties of 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide?
2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide has a molecular weight of 196.26 g/mol, XLogP of -0.96, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-(ethylamino)-N',3-bis(methylamino)prop-2-enimidamide is sourced from PubChem (CID 174021445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).