About CID 174021484
CID 174021484 (PubChem CID 174021484) has the molecular formula C8H9BFN3O2
and a molecular weight of 208.99 g/mol.
Molecular Properties
| Compound Name | CID 174021484 |
| PubChem CID | 174021484 |
| Molecular Formula | C8H9BFN3O2 |
| Molecular Weight | 208.99 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | — |
| SMILES | [B]n1c(=O)n2n(c1=O)C(CCF)C=CC2 |
| InChI | InChI=1S/C8H9BFN3O2/c9-12-7(14)11-5-1-2-6(3-4-10)13(11)8(12)15/h1-2,6H,3-5H2 |
| InChIKey | DXQUDBUAOAXODC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.99 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 174021484 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174021484?
The IUPAC name of CID 174021484 (CID 174021484) is not available.
What is the SMILES notation for CID 174021484?
The canonical SMILES for CID 174021484 is [B]n1c(=O)n2n(c1=O)C(CCF)C=CC2.
What is the InChIKey of CID 174021484?
The InChIKey is DXQUDBUAOAXODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BFN3O2/c9-12-7(14)11-5-1-2-6(3-4-10)13(11)8(12)15/h1-2,6H,3-5H2.
What are the key properties of CID 174021484?
CID 174021484 has a molecular weight of 208.99 g/mol, XLogP of -0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174021484 is sourced from PubChem (CID 174021484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).