C22H34O7Si — CID 174021822
methyl 2-[(1R,4S,8R,9R,12R)-10-hydroxy-4,8-dimethyl-3,5-dioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-6-en-9-yl]acetate (PubChem CID 174021822) has the molecular formula C22H34O7Si and a molecular weight of 438.59 g/mol. Its IUPAC name is methyl 2-[(1R,4S,8R,9R,12R)-10-hydroxy-4,8-dimethyl-3,5-dioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-6-en-9-yl]acetate.
| Compound Name | methyl 2-[(1R,4S,8R,9R,12R)-10-hydroxy-4,8-dimethyl-3,5-dioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-6-en-9-yl]acetate |
|---|---|
| PubChem CID | 174021822 |
| Molecular Formula | C22H34O7Si |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | methyl 2-[(1R,4S,8R,9R,12R)-10-hydroxy-4,8-dimethyl-3,5-dioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-6-en-9-yl]acetate |
| SMILES | CC[Si](CC)(CC)OC1C(O)[C@H](CC(=O)OC)[C@@]2(C)C=CC(=O)[C@@]3(C)C(=O)O[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C22H34O7Si/c1-7-30(8-2,9-3)29-17-16(25)13(12-15(24)27-6)21(4)11-10-14(23)22(5)19(21)18(17)28-20(22)26/h10-11,13,16-19,25H,7-9,12H2,1-6H3/t13-,16?,17?,18-,19+,21+,22+/m0/s1 |
| InChIKey | BDCPIGOSLAUHHB-NSTXENBVSA-N |
| XLogP | 2.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|