C22H32O7Si — CID 174021823
methyl 2-[(1R,4R,8S,9R,12R)-4,8-dimethyl-3,7,10-trioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate (PubChem CID 174021823) has the molecular formula C22H32O7Si and a molecular weight of 436.58 g/mol. Its IUPAC name is methyl 2-[(1R,4R,8S,9R,12R)-4,8-dimethyl-3,7,10-trioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate.
| Compound Name | methyl 2-[(1R,4R,8S,9R,12R)-4,8-dimethyl-3,7,10-trioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate |
|---|---|
| PubChem CID | 174021823 |
| Molecular Formula | C22H32O7Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 2-[(1R,4R,8S,9R,12R)-4,8-dimethyl-3,7,10-trioxo-11-triethylsilyloxy-2-oxatricyclo[6.3.1.04,12]dodec-5-en-9-yl]acetate |
| SMILES | CC[Si](CC)(CC)OC1C(=O)[C@H](CC(=O)OC)[C@@]2(C)C(=O)C=C[C@@]3(C)C(=O)O[C@@H]1[C@H]23 |
| InChI | InChI=1S/C22H32O7Si/c1-7-30(8-2,9-3)29-17-16(25)13(12-15(24)27-6)22(5)14(23)10-11-21(4)19(22)18(17)28-20(21)26/h10-11,13,17-19H,7-9,12H2,1-6H3/t13-,17?,18-,19-,21+,22-/m0/s1 |
| InChIKey | UEQLBHVUJGGVQV-HLDUKZFNSA-N |
| XLogP | 2.83 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|