C27H22BClF4N4O4 — CID 174022082
CID 174022082 (PubChem CID 174022082) has the molecular formula C27H22BClF4N4O4 and a molecular weight of 588.75 g/mol.
| Compound Name | CID 174022082 |
|---|---|
| PubChem CID | 174022082 |
| Molecular Formula | C27H22BClF4N4O4 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | — |
| SMILES | [B][C@@]1(c2cc(F)cc(Cl)c2COc2cccc3c(-n4cc(F)cn4)cc(C)nc23)COCCN1C(=O)COC(F)F |
| InChI | InChI=1S/C27H22BClF4N4O4/c1-15-7-22(37-11-17(31)10-34-37)18-3-2-4-23(25(18)35-15)40-12-19-20(8-16(30)9-21(19)29)27(28)14-39-6-5-36(27)24(38)13-41-26(32)33/h2-4,7-11,26H,5-6,12-14H2,1H3/t27-/m0/s1 |
| InChIKey | UZUNJUUUEJDBQT-MHZLTWQESA-N |
| XLogP | 4.66 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|