C39H33N3Si — CID 174022105
[3-[1-ethenyl-2-[(Z)-prop-1-enyl]imidazo[1,2-a]benzimidazol-4-yl]phenyl]-(3-methylphenyl)-diphenylsilane (PubChem CID 174022105) has the molecular formula C39H33N3Si and a molecular weight of 571.80 g/mol. Its IUPAC name is [3-[1-ethenyl-2-[(Z)-prop-1-enyl]imidazo[1,2-a]benzimidazol-4-yl]phenyl]-(3-methylphenyl)-diphenylsilane.
| Compound Name | [3-[1-ethenyl-2-[(Z)-prop-1-enyl]imidazo[1,2-a]benzimidazol-4-yl]phenyl]-(3-methylphenyl)-diphenylsilane |
|---|---|
| PubChem CID | 174022105 |
| Molecular Formula | C39H33N3Si |
| Molecular Weight | 571.80 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | [3-[1-ethenyl-2-[(Z)-prop-1-enyl]imidazo[1,2-a]benzimidazol-4-yl]phenyl]-(3-methylphenyl)-diphenylsilane |
| SMILES | C=Cc1c(/C=C\C)nc2n(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4cccc(C)c4)c3)c3ccccc3n12 |
| InChI | InChI=1S/C39H33N3Si/c1-4-16-35-36(5-2)42-38-26-13-12-25-37(38)41(39(42)40-35)30-18-15-24-34(28-30)43(31-19-8-6-9-20-31,32-21-10-7-11-22-32)33-23-14-17-29(3)27-33/h4-28H,2H2,1,3H3/b16-4- |
| InChIKey | KTMNMCKQVJZTJL-XRVIQIRUSA-N |
| XLogP | 6.64 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.80 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|