C34H41N7OS — CID 174022305
tert-butyl-[3-[1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-1H-pyrazolo[3,4-b]pyrazin-6-yl]spiro[1,3-dihydroindene-2,4'-cyclohexene]-1-yl]propylamino]-oxidosulfanium (PubChem CID 174022305) has the molecular formula C34H41N7OS and a molecular weight of 595.82 g/mol. Its IUPAC name is tert-butyl-[3-[1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-1H-pyrazolo[3,4-b]pyrazin-6-yl]spiro[1,3-dihydroindene-2,4'-cyclohexene]-1-yl]propylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[3-[1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-1H-pyrazolo[3,4-b]pyrazin-6-yl]spiro[1,3-dihydroindene-2,4'-cyclohexene]-1-yl]propylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174022305 |
| Molecular Formula | C34H41N7OS |
| Molecular Weight | 595.82 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | tert-butyl-[3-[1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-1H-pyrazolo[3,4-b]pyrazin-6-yl]spiro[1,3-dihydroindene-2,4'-cyclohexene]-1-yl]propylamino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NCCCC1c2ccccc2CC12CC=C(c1cnc3c(N4CCCc5ncccc54)n[nH]c3n1)CC2 |
| InChI | InChI=1S/C34H41N7OS/c1-33(2,3)43(42)37-19-6-11-26-25-10-5-4-9-24(25)21-34(26)16-14-23(15-17-34)28-22-36-30-31(38-28)39-40-32(30)41-20-8-12-27-29(41)13-7-18-35-27/h4-5,7,9-10,13-14,18,22,26,37H,6,8,11-12,15-17,19-21H2,1-3H3,(H,38,39,40) |
| InChIKey | INQPSEJUJATOKQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|