C19H17N7 — CID 174022397
1,2-bis[(E)-2-(3-cyanophenyl)ethylideneamino]guanidine (PubChem CID 174022397) has the molecular formula C19H17N7 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1,2-bis[(E)-2-(3-cyanophenyl)ethylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-2-(3-cyanophenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 174022397 |
| Molecular Formula | C19H17N7 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1,2-bis[(E)-2-(3-cyanophenyl)ethylideneamino]guanidine |
| SMILES | N#Cc1cccc(C/C=N/N=C(N)N/N=C/Cc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C19H17N7/c20-13-17-5-1-3-15(11-17)7-9-23-25-19(22)26-24-10-8-16-4-2-6-18(12-16)14-21/h1-6,9-12H,7-8H2,(H3,22,25,26)/b23-9+,24-10+ |
| InChIKey | ZJRYMJNRXGWDLV-WDBPGAOMSA-N |
| XLogP | 2.09 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|