C20H24F3N7 — CID 174023270
1-[4-(4-aminophenyl)-5-[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]pyrimidin-2-yl]piperidin-4-amine (PubChem CID 174023270) has the molecular formula C20H24F3N7 and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-5-[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]pyrimidin-2-yl]piperidin-4-amine.
| Compound Name | 1-[4-(4-aminophenyl)-5-[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]pyrimidin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 174023270 |
| Molecular Formula | C20H24F3N7 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[4-(4-aminophenyl)-5-[1-amino-3-(2,2,2-trifluoroethylimino)prop-1-en-2-yl]pyrimidin-2-yl]piperidin-4-amine |
| SMILES | NC=C(/C=N/CC(F)(F)F)c1cnc(N2CCC(N)CC2)nc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C20H24F3N7/c21-20(22,23)12-27-10-14(9-24)17-11-28-19(30-7-5-16(26)6-8-30)29-18(17)13-1-3-15(25)4-2-13/h1-4,9-11,16H,5-8,12,24-26H2/b14-9?,27-10+ |
| InChIKey | DNBRECLBAUBOSY-KMNMAXBBSA-N |
| XLogP | 2.59 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|