C51H37BClN3O2S2 — CID 174024344
2-chloro-4-(2-phenylphenyl)-6-[2-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-yl]dibenzothiophen-4-yl]-1,3,5-triazine (PubChem CID 174024344) has the molecular formula C51H37BClN3O2S2 and a molecular weight of 834.28 g/mol. Its IUPAC name is 2-chloro-4-(2-phenylphenyl)-6-[2-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-yl]dibenzothiophen-4-yl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2-phenylphenyl)-6-[2-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-yl]dibenzothiophen-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174024344 |
| Molecular Formula | C51H37BClN3O2S2 |
| Molecular Weight | 834.28 g/mol |
| Exact Mass | 833.21 |
| IUPAC Name | 2-chloro-4-(2-phenylphenyl)-6-[2-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophen-2-yl]dibenzothiophen-4-yl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(-c3cccc4c3sc3ccc(-c5cc(-c6nc(Cl)nc(-c7ccccc7-c7ccccc7)n6)c6sc7ccccc7c6c5)cc34)c2)OC1(C)C |
| InChI | InChI=1S/C51H37BClN3O2S2/c1-50(2)51(3,4)58-52(57-50)34-17-12-16-32(26-34)36-21-13-22-38-40-27-31(24-25-44(40)60-45(36)38)33-28-41-37-19-10-11-23-43(37)59-46(41)42(29-33)48-54-47(55-49(53)56-48)39-20-9-8-18-35(39)30-14-6-5-7-15-30/h5-29H,1-4H3 |
| InChIKey | KDHFWVVCKPVJAW-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.28 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|