C25H38FN3 — CID 174024421
3-(ethenyliminomethyl)-2-N-[2-(3-fluorophenyl)propyl]-2-N,4-N-bis(2-methylpropyl)penta-1,3-diene-2,4-diamine (PubChem CID 174024421) has the molecular formula C25H38FN3 and a molecular weight of 399.60 g/mol. Its IUPAC name is 3-(ethenyliminomethyl)-2-N-[2-(3-fluorophenyl)propyl]-2-N,4-N-bis(2-methylpropyl)penta-1,3-diene-2,4-diamine.
| Compound Name | 3-(ethenyliminomethyl)-2-N-[2-(3-fluorophenyl)propyl]-2-N,4-N-bis(2-methylpropyl)penta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 174024421 |
| Molecular Formula | C25H38FN3 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 3-(ethenyliminomethyl)-2-N-[2-(3-fluorophenyl)propyl]-2-N,4-N-bis(2-methylpropyl)penta-1,3-diene-2,4-diamine |
| SMILES | C=C/N=C/C(C(=C)N(CC(C)C)CC(C)c1cccc(F)c1)=C(C)NCC(C)C |
| InChI | InChI=1S/C25H38FN3/c1-9-27-15-25(21(7)28-14-18(2)3)22(8)29(16-19(4)5)17-20(6)23-11-10-12-24(26)13-23/h9-13,15,18-20,28H,1,8,14,16-17H2,2-7H3/b25-21?,27-15+ |
| InChIKey | WZFMEVQBEBVNSN-BFCVIXSWSA-N |
| XLogP | 6.13 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|