C17H22BF2NO3 — CID 174024776
(3,3-difluoropyrrolidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 174024776) has the molecular formula C17H22BF2NO3 and a molecular weight of 337.18 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 174024776 |
| Molecular Formula | C17H22BF2NO3 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCC(F)(F)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C17H22BF2NO3/c1-15(2)16(3,4)24-18(23-15)13-7-5-12(6-8-13)14(22)21-10-9-17(19,20)11-21/h5-8H,9-11H2,1-4H3 |
| InChIKey | GXPWPEUUCKLSJW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|