C31H45FN6O3S — CID 174024830
N-ethyl-2-[4-[(2S)-2-[[[4-(ethylsulfanyliminomethyl)cyclohexyl]methylamino]methyl]morpholin-4-yl]pyrimidin-5-yl]oxy-5-fluoro-N-propan-2-ylbenzamide (PubChem CID 174024830) has the molecular formula C31H45FN6O3S and a molecular weight of 600.81 g/mol. Its IUPAC name is N-ethyl-2-[4-[(2S)-2-[[[4-(ethylsulfanyliminomethyl)cyclohexyl]methylamino]methyl]morpholin-4-yl]pyrimidin-5-yl]oxy-5-fluoro-N-propan-2-ylbenzamide.
| Compound Name | N-ethyl-2-[4-[(2S)-2-[[[4-(ethylsulfanyliminomethyl)cyclohexyl]methylamino]methyl]morpholin-4-yl]pyrimidin-5-yl]oxy-5-fluoro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 174024830 |
| Molecular Formula | C31H45FN6O3S |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | N-ethyl-2-[4-[(2S)-2-[[[4-(ethylsulfanyliminomethyl)cyclohexyl]methylamino]methyl]morpholin-4-yl]pyrimidin-5-yl]oxy-5-fluoro-N-propan-2-ylbenzamide |
| SMILES | CCSN=CC1CCC(CNC[C@H]2CN(c3ncncc3Oc3ccc(F)cc3C(=O)N(CC)C(C)C)CCO2)CC1 |
| InChI | InChI=1S/C31H45FN6O3S/c1-5-38(22(3)4)31(39)27-15-25(32)11-12-28(27)41-29-19-34-21-35-30(29)37-13-14-40-26(20-37)18-33-16-23-7-9-24(10-8-23)17-36-42-6-2/h11-12,15,17,19,21-24,26,33H,5-10,13-14,16,18,20H2,1-4H3/t23?,24?,26-/m0/s1 |
| InChIKey | YKJPLZQDMMSNKL-RSMFLLDRSA-N |
| XLogP | 5.62 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|