C26H30BN5O3 — CID 174024856
2-hydrazinylidene-3-(2-methylphenyl)imino-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanamide (PubChem CID 174024856) has the molecular formula C26H30BN5O3 and a molecular weight of 471.37 g/mol. Its IUPAC name is 2-hydrazinylidene-3-(2-methylphenyl)imino-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanamide.
| Compound Name | 2-hydrazinylidene-3-(2-methylphenyl)imino-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanamide |
|---|---|
| PubChem CID | 174024856 |
| Molecular Formula | C26H30BN5O3 |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-hydrazinylidene-3-(2-methylphenyl)imino-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanamide |
| SMILES | C/C(=N\c1ccccc1C)C(=NN)C(=O)Nc1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C26H30BN5O3/c1-16-9-7-8-10-20(16)29-17(2)23(32-28)24(33)31-22-14-11-18-15-19(12-13-21(18)30-22)27-34-25(3,4)26(5,6)35-27/h7-15H,28H2,1-6H3,(H,30,31,33)/b29-17+,32-23? |
| InChIKey | LGEBRLPYGQVYIX-UGFKCPRMSA-N |
| XLogP | 3.89 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|