C30H32ClFN9OSi — CID 174024887
CID 174024887 (PubChem CID 174024887) has the molecular formula C30H32ClFN9OSi and a molecular weight of 617.19 g/mol.
| Compound Name | CID 174024887 |
|---|---|
| PubChem CID | 174024887 |
| Molecular Formula | C30H32ClFN9OSi |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | — |
| SMILES | Nc1nccn2c(N3CCC4(CC3)CN(C([Si])[C@H]3CCNC3)C4)nc(-c3ccc(C(=O)Nc4cc(Cl)ccn4)cc3F)c12 |
| InChI | InChI=1S/C30H32ClFN9OSi/c31-20-4-8-35-23(14-20)37-27(42)18-1-2-21(22(32)13-18)24-25-26(33)36-9-12-41(25)29(38-24)39-10-5-30(6-11-39)16-40(17-30)28(43)19-3-7-34-15-19/h1-2,4,8-9,12-14,19,28,34H,3,5-7,10-11,15-17H2,(H2,33,36)(H,35,37,42)/t19-,28?/m0/s1 |
| InChIKey | WEWYJQHLOUYMJD-ZAFBDEJNSA-N |
| XLogP | 3.42 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|