C14H27N3 — CID 174024920
(6E)-2-N,4-N,3-trimethyl-5-(methyliminomethyl)nona-4,6-diene-2,4-diamine (PubChem CID 174024920) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (6E)-2-N,4-N,3-trimethyl-5-(methyliminomethyl)nona-4,6-diene-2,4-diamine.
| Compound Name | (6E)-2-N,4-N,3-trimethyl-5-(methyliminomethyl)nona-4,6-diene-2,4-diamine |
|---|---|
| PubChem CID | 174024920 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (6E)-2-N,4-N,3-trimethyl-5-(methyliminomethyl)nona-4,6-diene-2,4-diamine |
| SMILES | CC/C=C/C(/C=N/C)=C(NC)C(C)C(C)NC |
| InChI | InChI=1S/C14H27N3/c1-7-8-9-13(10-15-4)14(17-6)11(2)12(3)16-5/h8-12,16-17H,7H2,1-6H3/b9-8+,14-13?,15-10+ |
| InChIKey | ZUMCGPDORDUUOH-JCBVDXGXSA-N |
| XLogP | 2.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|