C42H18B10N2S2 — CID 174025075
CID 174025075 (PubChem CID 174025075) has the molecular formula C42H18B10N2S2 and a molecular weight of 722.87 g/mol.
| Compound Name | CID 174025075 |
|---|---|
| PubChem CID | 174025075 |
| Molecular Formula | C42H18B10N2S2 |
| Molecular Weight | 722.87 g/mol |
| Exact Mass | 724.18 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2ccc3sc4ccccc4c3c2)c2cccc3c2sc2cccc(N(c4ccccc4)c4c([B])c([B])c([B])c([B])c4[B])c23)c([B])c1[B] |
| InChI | InChI=1S/C42H18B10N2S2/c43-30-32(45)36(49)40(37(50)33(30)46)53(19-8-2-1-3-9-19)24-12-7-15-28-29(24)22-11-6-13-25(42(22)56-28)54(41-38(51)34(47)31(44)35(48)39(41)52)20-16-17-27-23(18-20)21-10-4-5-14-26(21)55-27/h1-18H |
| InChIKey | HZOIXQWHNGZJET-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.87 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|