About CID 174025446
CID 174025446 (PubChem CID 174025446) has the molecular formula C20H23BN5OP
and a molecular weight of 391.22 g/mol.
Molecular Properties
| Compound Name | CID 174025446 |
| PubChem CID | 174025446 |
| Molecular Formula | C20H23BN5OP |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | — |
| SMILES | [H]/N=C/CCNc1nc(-c2ccc(C)cc2)nn1-c1ccc(OC([B])(C)P)cc1 |
| InChI | InChI=1S/C20H23BN5OP/c1-14-4-6-15(7-5-14)18-24-19(23-13-3-12-22)26(25-18)16-8-10-17(11-9-16)27-20(2,21)28/h4-12,22H,3,13,28H2,1-2H3,(H,23,24,25)/b22-12+ |
| InChIKey | VEFAOUWQJYSBFT-WSDLNYQXSA-N |
| XLogP | 3.79 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174025446 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174025446?
The IUPAC name of CID 174025446 (CID 174025446) is not available.
What is the SMILES notation for CID 174025446?
The canonical SMILES for CID 174025446 is [H]/N=C/CCNc1nc(-c2ccc(C)cc2)nn1-c1ccc(OC([B])(C)P)cc1.
What is the InChIKey of CID 174025446?
The InChIKey is VEFAOUWQJYSBFT-WSDLNYQXSA-N. The full InChI is InChI=1S/C20H23BN5OP/c1-14-4-6-15(7-5-14)18-24-19(23-13-3-12-22)26(25-18)16-8-10-17(11-9-16)27-20(2,21)28/h4-12,22H,3,13,28H2,1-2H3,(H,23,24,25)/b22-12+.
What are the key properties of CID 174025446?
CID 174025446 has a molecular weight of 391.22 g/mol, XLogP of 3.79, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174025446 is sourced from PubChem (CID 174025446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).