C8H14O — CID 174025455
(2R,3S,5S)-5-ethenyl-2,3-dimethyloxolane (PubChem CID 174025455) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2R,3S,5S)-5-ethenyl-2,3-dimethyloxolane.
| Compound Name | (2R,3S,5S)-5-ethenyl-2,3-dimethyloxolane |
|---|---|
| PubChem CID | 174025455 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2R,3S,5S)-5-ethenyl-2,3-dimethyloxolane |
| SMILES | C=C[C@@H]1C[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C8H14O/c1-4-8-5-6(2)7(3)9-8/h4,6-8H,1,5H2,2-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | MVKNHAAPBNJZHC-XLPZGREQSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|