About (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine
(2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine (PubChem CID 174025767) has the molecular formula C9H16F3N
and a molecular weight of 195.23 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine.
Molecular Properties
| Compound Name | (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine |
| PubChem CID | 174025767 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine |
| SMILES | C=CCCC(N)C[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N/c1-3-4-5-8(13)6-7(2)9(10,11)12/h3,7-8H,1,4-6,13H2,2H3/t7-,8?/m1/s1 |
| InChIKey | HWRXCASSSMKMEX-GVHYBUMESA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine?
The IUPAC name of (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine (CID 174025767) is (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine.
What is the SMILES notation for (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine?
The canonical SMILES for (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine is C=CCCC(N)C[C@@H](C)C(F)(F)F.
What is the InChIKey of (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine?
The InChIKey is HWRXCASSSMKMEX-GVHYBUMESA-N. The full InChI is InChI=1S/C9H16F3N/c1-3-4-5-8(13)6-7(2)9(10,11)12/h3,7-8H,1,4-6,13H2,2H3/t7-,8?/m1/s1.
What are the key properties of (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine?
(2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine has a molecular weight of 195.23 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,1-trifluoro-2-methyloct-7-en-4-amine is sourced from PubChem (CID 174025767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).