About 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide
3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide (PubChem CID 174026171) has the molecular formula C10H17N3O2S4
and a molecular weight of 339.53 g/mol. Its IUPAC name is 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide.
Molecular Properties
| Compound Name | 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide |
| PubChem CID | 174026171 |
| Molecular Formula | C10H17N3O2S4 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide |
| SMILES | CC(C)N1C(=O)CC(SCCC(N)=NS(=S)S)C1=O |
| InChI | InChI=1S/C10H17N3O2S4/c1-6(2)13-9(14)5-7(10(13)15)18-4-3-8(11)12-19(16)17/h6-7H,3-5H2,1-2H3,(H2,11,12)(H,16,17) |
| InChIKey | YKHXDIFPZIKZOT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide?
The IUPAC name of 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide (CID 174026171) is 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide.
What is the SMILES notation for 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide?
The canonical SMILES for 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide is CC(C)N1C(=O)CC(SCCC(N)=NS(=S)S)C1=O.
What is the InChIKey of 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide?
The InChIKey is YKHXDIFPZIKZOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S4/c1-6(2)13-9(14)5-7(10(13)15)18-4-3-8(11)12-19(16)17/h6-7H,3-5H2,1-2H3,(H2,11,12)(H,16,17).
What are the key properties of 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide?
3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide has a molecular weight of 339.53 g/mol, XLogP of 0.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanyl-N'-sulfanylsulfinothioylpropanimidamide is sourced from PubChem (CID 174026171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).