C21H21N3O5S — CID 17402658
oxalic acid;2-[1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 17402658) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is oxalic acid;2-[1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | oxalic acid;2-[1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 17402658 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | oxalic acid;2-[1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | CC(c1nnc(-c2cccs2)o1)N1CC=C(c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H19N3OS.C2H2O4/c1-14(18-20-21-19(23-18)17-8-5-13-24-17)22-11-9-16(10-12-22)15-6-3-2-4-7-15;3-1(4)2(5)6/h2-9,13-14H,10-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | DREUAQWLTQHDOA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|